Loading distributor info...
| Description | NSC 95397 is a selective and effective dual-specificity, quinone-based phosphatase inhibitor. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A11470 |
|---|---|
| Formula | C14H14O4S2 |
| Molecular Weight | 310.38 |
| CAS Number | 93718-83-3 |
| SMILES | O=C1C2=CC=CC=C2C(C(SCCO)=C1SCCO)=O |
| Synonyms | NSC95397, NSC-95397 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 58 mg/mL (186.85 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (6.44 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.22 mL | 161.09 mL | 322.19 mL |
| 0.5 mM | 6.44 mL | 32.22 mL | 64.44 mL |
| 1 mM | 3.22 mL | 16.11 mL | 32.22 mL |
| 5 mM | 0.64 mL | 3.22 mL | 6.44 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
