Loading distributor info...
| Description | Oxybutynin(Ditropan) is an anticholinergic medication used to relieve urinary and bladder difficulties. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A10684 |
|---|---|
| Formula | C22H31NO3 |
| Molecular Weight | 357.49 |
| CAS Number | 5633-20-5 |
| SMILES | CCN(CC)CC#CCOC(=O)C(C1CCCCC1)(C2=CC=CC=C2)O |
| Synonyms | Ditropan, Lyrinel XL, Oxytrol |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 67 mg/mL (187.41 mM) | |
| Water | Insoluble | ||
| Ethanol | 67 mg/mL (187.41 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.97 mL | 139.86 mL | 279.73 mL |
| 0.5 mM | 5.59 mL | 27.97 mL | 55.95 mL |
| 1 mM | 2.8 mL | 13.99 mL | 27.97 mL |
| 5 mM | 0.56 mL | 2.8 mL | 5.59 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
