QNZ (EVP4593)
QNZ inhibits the activation of the transcription factor NF-κB and has been used to investigate NF-κB signaling.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | QNZ inhibits the activation of the transcription factor NF-κB and has been used to investigate NF-κB signaling. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12748 |
|---|---|
| Formula | C22H20N4O |
| Molecular Weight | 356.4 |
| CAS Number | 545380-34-5 |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)CCNC3=NC=NC4=C3C=C(C=C4)N |
| Synonyms | CAY10470, CAY 10470, CAY-10470 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 5 mg/mL (14.02 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 0.5% hydroxyethyl cellulose | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.06 mL | 140.29 mL | 280.58 mL |
| 0.5 mM | 5.61 mL | 28.06 mL | 56.12 mL |
| 1 mM | 2.81 mL | 14.03 mL | 28.06 mL |
| 5 mM | 0.56 mL | 2.81 mL | 5.61 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2