Loading distributor info...
| Description | Salicin(Salicoside, Salicine) is an alcoholic β-glycoside that contains D-glucose. Salicin is an anti-inflammatory agent that is produced from willow bark. Salicin is closely related in chemical make-up to aspirin. When consumed, it is metabolized to salicylic acid. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10820 |
|---|---|
| Formula | C13H18O7 |
| Molecular Weight | 286.3 |
| CAS Number | 138-52-3 |
| SMILES | C1=CC=C(C(=C1)CO)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
| Synonyms | Salicoside, Salicine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 52 mg/mL (181.64 mM) | |
| Water | 22 mg/mL (76.84 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.93 mL | 174.64 mL | 349.28 mL |
| 0.5 mM | 6.99 mL | 34.93 mL | 69.86 mL |
| 1 mM | 3.49 mL | 17.46 mL | 34.93 mL |
| 5 mM | 0.7 mL | 3.49 mL | 6.99 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
