Loading distributor info...
| Description | SB-3CT is an effective and selective gelatinase inhibitor with Ki of 13.9 nM and 600 nM for MMP-2 and MMP-9. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14253 |
|---|---|
| Formula | C15H14O3S2 |
| Molecular Weight | 306.4 |
| CAS Number | 292605-14-2 |
| SMILES | C1C(S1)CS(=O)(=O)C2=CC=C(C=C2)OC3=CC=CC=C3 |
| Synonyms | SB3CT |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 54 mg/mL (176.23 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 9 mg/mL (29.37 mM) | ||
| In vivo | 4% DMSO+corn oil | 9 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.64 mL | 163.19 mL | 326.37 mL |
| 0.5 mM | 6.53 mL | 32.64 mL | 65.27 mL |
| 1 mM | 3.26 mL | 16.32 mL | 32.64 mL |
| 5 mM | 0.65 mL | 3.26 mL | 6.53 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
