Loading distributor info...
| Description | Tanshinones are the major bioactive compounds of Salvia miltiorrhiza Bunge (Danshen) roots, which are used in many therapeutic remedies in Chinese traditional medicine. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A10889 |
|---|---|
| Formula | C18H12O3 |
| Molecular Weight | 276.3 |
| CAS Number | 568-73-0 |
| SMILES | CC1=CC=CC2=C1C=CC3=C2C(=O)C(=O)C4=C3OC=C4C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 21 mg/mL (76 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.19 mL | 180.96 mL | 361.93 mL |
| 0.5 mM | 7.24 mL | 36.19 mL | 72.39 mL |
| 1 mM | 3.62 mL | 18.1 mL | 36.19 mL |
| 5 mM | 0.72 mL | 3.62 mL | 7.24 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
