TCS JNK 5a is a highly selective inhibitor of JNK2 and JNK3 (pIC50 values are 6.7, 6.5, <5.0 and <4.8 for JNK3, JNK2, JNK1 and p38α respectively).
Loading distributor info...
| Description | TCS JNK 5a is a highly selective inhibitor of JNK2 and JNK3 (pIC50 values are 6.7, 6.5, <5.0 and <4.8 for JNK3, JNK2, JNK1 and p38α respectively). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11969 |
|---|---|
| Formula | C20H16N2OS |
| Molecular Weight | 332.42 |
| CAS Number | 312917-14-9 |
| SMILES | C1CCC2=C(C1)C(=C(S2)NC(=O)C3=CC=CC4=CC=CC=C43)C#N |
| Synonyms | JNK Inhibitor IX |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 19 mg/mL (57.15 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.08 mL | 150.41 mL | 300.82 mL |
| 0.5 mM | 6.02 mL | 30.08 mL | 60.16 mL |
| 1 mM | 3.01 mL | 15.04 mL | 30.08 mL |
| 5 mM | 0.6 mL | 3.01 mL | 6.02 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
