TG100-115
Catalog No.: A10922
PI3K Inhibitor
TG100-115 inhibits PI3K γ and -δ(IC50 values of 83 and 235 nM, respectively).
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | TG100-115 inhibits PI3K γ and -δ(IC50 values of 83 and 235 nM, respectively). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10922 |
|---|---|
| Formula | C18H14N6O2 |
| Molecular Weight | 346.3 |
| CAS Number | 677297-51-7 |
| SMILES | C1=CC(=CC(=C1)O)C2=NC3=C(N=C2C4=CC(=CC=C4)O)N=C(N=C3N)N |
| Synonyms | TG100115 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 8 mg/mL (23.09 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+30% PEG 300+ddH2O | 0.3 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.88 mL | 144.38 mL | 288.77 mL |
| 0.5 mM | 5.78 mL | 28.88 mL | 57.75 mL |
| 1 mM | 2.89 mL | 14.44 mL | 28.88 mL |
| 5 mM | 0.58 mL | 2.89 mL | 5.78 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2