YM201636
YM201636 is a cell-permeable and selective inhibitor of PIKfyve (IC50 = 33 nM).
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | YM201636 is a cell-permeable and selective inhibitor of PIKfyve (IC50 = 33 nM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11064 |
|---|---|
| Formula | C25H21N7O3 |
| Molecular Weight | 467.5 |
| CAS Number | 371942-69-7 |
| SMILES | C1COCCN1C2=NC(=NC3=C2OC4=C3C=CC=N4)C5=CC(=CC=C5)NC(=O)C6=CN=C(C=C6)N |
| Synonyms | YM-201636 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 31 mg/mL (66.3 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.39 mL | 106.95 mL | 213.9 mL |
| 0.5 mM | 4.28 mL | 21.39 mL | 42.78 mL |
| 1 mM | 2.14 mL | 10.7 mL | 21.39 mL |
| 5 mM | 0.43 mL | 2.14 mL | 4.28 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2