1,3-Diphenylisobenzofuran (DPBF) is a fluorescent probe developed for the selective detection and quantification of hydrogen peroxide in the presence of various reactive nitrogen and oxygen species (RNOS). For nearly two decades, DPBF has been widely used as a specific indicator for reactive oxygen species, particularly singlet oxygen, hydroxyl radicals, alkoxyl radicals, and alkylperoxy radicals.
1,3-Diphenylisobenzofuran (DPBF) is a fluorescent probe developed for the selective detection and quantification of hydrogen peroxide in the presence of various reactive nitrogen and oxygen species (RNOS). For nearly two decades, DPBF has been widely used as a specific indicator for reactive oxygen species, particularly singlet oxygen, hydroxyl radicals, alkoxyl radicals, and alkylperoxy radicals.
Product Information
Catalog Num
A24510
Formula
C20H14O
Molecular Weight
270.33
CAS Number
5471-63-6
SMILES
C1(C2=CC=CC=C2)=C3C=CC=CC3=C(C4=CC=CC=C4)O1
Storage
Store lyophilized at -20ºC, keep desiccated. In lyophilized form, the chemical is stable for 36 months. In solution, store at -20ºC and use within 1 months to prevent loss of potency. Aliquot to avoid multiple freeze/thaw cycles.
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
