Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 10058-F4 is a c-Myc inhibitor that prevents c-Myc/Max dimerization. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13725 |
|---|---|
| Formula | C12H11NOS2 |
| Molecular Weight | 249.35 |
| CAS Number | 403811-55-2 |
| SMILES | CCC1=CC=C(C=C1)/C=C/2\C(=O)NC(=S)S2 |
| Synonyms | 10058F4 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 43 mg/mL (172.45 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (12.03 mM) | ||
| In vivo | 2% DMSO+corn oil | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.1 mL | 200.52 mL | 401.04 mL |
| 0.5 mM | 8.02 mL | 40.1 mL | 80.21 mL |
| 1 mM | 4.01 mL | 20.05 mL | 40.1 mL |
| 5 mM | 0.8 mL | 4.01 mL | 8.02 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
