Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 4-Hydroxychalcone is a chalcone metabolite with anti-angiogenic and anti-inflammatory activities. |
|---|
| Catalog Num | A19662 |
|---|---|
| Formula | C15H12O2 |
| Molecular Weight | 224.25 |
| CAS Number | 20426-12-4 |
| SMILES | O=C(C1=CC=CC=C1)/C=C/C2=CC=C(O)C=C2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 37 mg/mL (164.99 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 44.59 mL | 222.97 mL | 445.93 mL |
| 0.5 mM | 8.92 mL | 44.59 mL | 89.19 mL |
| 1 mM | 4.46 mL | 22.3 mL | 44.59 mL |
| 5 mM | 0.89 mL | 4.46 mL | 8.92 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
