Loading distributor info...
| Description | 4'-Methoxychalcone regulates adipocyte differentiation through PPARγ activation. 4'-Methoxychalcone modulates the expression and secretion of various adipokines in adipose tissue that are involved in insulin sensitivity. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A18539 |
|---|---|
| Formula | C16H14O2 |
| Molecular Weight | 238.28 |
| CAS Number | 959-23-9 |
| SMILES | O=C(C1=CC=C(OC)C=C1)/C=C/C2=CC=CC=C2 |
| Synonyms | 4-Methoxychalcone |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 47 mg/mL (197.24 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (8.39 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.97 mL | 209.84 mL | 419.67 mL |
| 0.5 mM | 8.39 mL | 41.97 mL | 83.93 mL |
| 1 mM | 4.2 mL | 20.98 mL | 41.97 mL |
| 5 mM | 0.84 mL | 4.2 mL | 8.39 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
