Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 4-O-Caffeoylquinic acid, also known as cryptochlorogenic acid, is an isomer of chlorogenic acid and possesses antioxidant properties. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12036 |
|---|---|
| Formula | C16H18O9 |
| Molecular Weight | 354.31 |
| CAS Number | 905-99-7 |
| SMILES | C1[C@H](C([C@@H](CC1(C(=O)O)O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)O |
| Synonyms | cryptochlorogenic acid |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 62 mg/mL (174.98 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.22 mL | 141.12 mL | 282.24 mL |
| 0.5 mM | 5.64 mL | 28.22 mL | 56.45 mL |
| 1 mM | 2.82 mL | 14.11 mL | 28.22 mL |
| 5 mM | 0.56 mL | 2.82 mL | 5.64 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
