Loading distributor info...
| Description | 4-Octyl Itaconate is a cell-permeable Itaconate derivative. Itaconate is an anti-inflammatory metabolite that activates Nrf2 via alkylation of KEAP1. |
|---|
| Catalog Num | A19731 |
|---|---|
| Formula | C13H22O4 |
| Molecular Weight | 242.31 |
| CAS Number | 3133-16-2 |
| SMILES | O=C(OCCCCCCCC)CC(C(O)=O)=C |
| Synonyms | 4 Octyl Itaconate; 4-Octyl-Itaconate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 45 mg/mL (185.71 mM) | |
| Water | Insoluble | ||
| Ethanol | 45 mg/mL (185.71 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.27 mL | 206.35 mL | 412.69 mL |
| 0.5 mM | 8.25 mL | 41.27 mL | 82.54 mL |
| 1 mM | 4.13 mL | 20.63 mL | 41.27 mL |
| 5 mM | 0.83 mL | 4.13 mL | 8.25 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
