Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 5-BrdU is a synthetic thymidine analog; incorporated into DNA during replication. Used in assays for cell proliferation. |
|---|
| Catalog Num | A13369 |
|---|---|
| Formula | C9H11BrN2O5 |
| Molecular Weight | 307.1 |
| CAS Number | 59-14-3 |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=C(C(=O)NC2=O)Br)CO)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (182.35 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 2 mg/mL (6.51 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.56 mL | 162.81 mL | 325.63 mL |
| 0.5 mM | 6.51 mL | 32.56 mL | 65.13 mL |
| 1 mM | 3.26 mL | 16.28 mL | 32.56 mL |
| 5 mM | 0.65 mL | 3.26 mL | 6.51 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
