Loading distributor info...
| Description | 6-Benzylaminopurine is a first-generation synthetic cytokinin which could regulate the activities of the antioxidant defense system of plants.Its treatment elicits plant growth and development. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A13053 |
|---|---|
| Formula | C12H11N5 |
| Molecular Weight | 225.25 |
| CAS Number | 1214-39-7 |
| SMILES | C1=CC=C(C=C1)CNC2=NC=NC3=C2NC=N3 |
| Synonyms | 6-BAP, BA, N6-Benzyladenine, Benzyladenine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 42 mg/mL (186.45 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 44.4 mL | 221.98 mL | 443.95 mL |
| 0.5 mM | 8.88 mL | 44.4 mL | 88.79 mL |
| 1 mM | 4.44 mL | 22.2 mL | 44.4 mL |
| 5 mM | 0.89 mL | 4.44 mL | 8.88 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
