Loading distributor info...
| Description | 7ACC2 is a new potent MCT inhibitor with IC50 of 11 nM for inhibition of [14C]-lactate influx; new antitumor treatment targeting lactate transport in cancer cells. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A15785 |
|---|---|
| Formula | C18H15NO4 |
| Molecular Weight | 309.32 |
| CAS Number | 1472624-85-3 |
| SMILES | CN(CC1=CC=CC=C1)C2=CC3=C(C=C2)C=C(C(=O)O3)C(=O)O |
| Synonyms | 7ACC 2, 7ACC-2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 54 mg/mL (174.57 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.33 mL | 161.64 mL | 323.29 mL |
| 0.5 mM | 6.47 mL | 32.33 mL | 64.66 mL |
| 1 mM | 3.23 mL | 16.16 mL | 32.33 mL |
| 5 mM | 0.65 mL | 3.23 mL | 6.47 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
