Loading distributor info...
| Description | 8-Gingerol is a bioactive ingredient of ginger (Zingiber officinale) having anti-nausea, anti-inflammatory, and anti-carcinogenic properties. |
|---|
| Catalog Num | A14476 |
|---|---|
| Formula | C19H30O4 |
| Molecular Weight | 322.44 |
| CAS Number | 23513-08-8 |
| SMILES | CCCCCCCC(CC(=O)CCC1=CC(=C(C=C1)O)OC)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (173.67 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.01 mL | 155.07 mL | 310.14 mL |
| 0.5 mM | 6.2 mL | 31.01 mL | 62.03 mL |
| 1 mM | 3.1 mL | 15.51 mL | 31.01 mL |
| 5 mM | 0.62 mL | 3.1 mL | 6.2 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
