Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Aminoacridine is a highly fluorescent dye used as a topical antiseptic. It is sometimes used experimentally as a mutagen due to its interaction with DNA. It is also used as an intracellular pH indicator. |
|---|
| Catalog Num | A18172 |
|---|---|
| Formula | C13H10N2 |
| Molecular Weight | 194.24 |
| CAS Number | 90-45-9 |
| SMILES | NC1=C(C=CC=C2)C2=NC3=CC=CC=C31 |
| Synonyms | Aminoacridine; NSC 13000; NSC-13000; NSC13000 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 35 mg/mL (180.19 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 35 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 51.48 mL | 257.41 mL | 514.83 mL |
| 0.5 mM | 10.3 mL | 51.48 mL | 102.97 mL |
| 1 mM | 5.15 mL | 25.74 mL | 51.48 mL |
| 5 mM | 1.03 mL | 5.15 mL | 10.3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
