Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Abscisic Acid is a plant hormone, which is involved in many plant developmental processes, modulates ion homeostasis and metabolism. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14224 |
|---|---|
| Formula | C15H20O4 |
| Molecular Weight | 264.32 |
| CAS Number | 21293-29-8 |
| SMILES | CC1=CC(=O)CC([C@]1(/C=C/C(=C\C(=O)O)/C)O)(C)C |
| Synonyms | Abscisin II, Dormin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 48 mg/mL (181.6 mM) | |
| Water | Insoluble | ||
| Ethanol | 48 mg/mL (181.6 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.83 mL | 189.16 mL | 378.33 mL |
| 0.5 mM | 7.57 mL | 37.83 mL | 75.67 mL |
| 1 mM | 3.78 mL | 18.92 mL | 37.83 mL |
| 5 mM | 0.76 mL | 3.78 mL | 7.57 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
