Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Acitretin is a second generation retinoid and is typically used for psoriasis. |
|---|
| Catalog Num | A10035 |
|---|---|
| Formula | C21H26O3 |
| Molecular Weight | 326.4 |
| CAS Number | 55079-83-9 |
| SMILES | CC1=CC(=C(C(=C1/C=C/C(=C/C=C/C(=C/C(=O)O)/C)/C)C)C)OC |
| Synonyms | Soriatane, Neotigason |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 17 mg/mL (52.07 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.64 mL | 153.19 mL | 306.37 mL |
| 0.5 mM | 6.13 mL | 30.64 mL | 61.27 mL |
| 1 mM | 3.06 mL | 15.32 mL | 30.64 mL |
| 5 mM | 0.61 mL | 3.06 mL | 6.13 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
