Loading distributor info...
| Description | ACP-105 is an orally available, selective amd potent androgen receptor modulator (SARM), with pEC50s of 9.0 and 9.3 for AR wild type and T877A mutant, respectively. |
|---|
| Catalog Num | A19778 |
|---|---|
| Formula | C16H19ClN2O |
| Molecular Weight | 290.79 |
| CAS Number | 899821-23-9 |
| SMILES | N#CC1=CC=C(N2[C@@H]3C[C@](O)(C)C[C@H]2CC3)C(C)=C1Cl |
| Synonyms | ACP105, ACP 105 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL | |
| Water | Insoluble | ||
| Ethanol | 56 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.39 mL | 171.95 mL | 343.89 mL |
| 0.5 mM | 6.88 mL | 34.39 mL | 68.78 mL |
| 1 mM | 3.44 mL | 17.19 mL | 34.39 mL |
| 5 mM | 0.69 mL | 3.44 mL | 6.88 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
