Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AG-1024 (Tyrphostin) is a specific inhibitor of insulin-like growth factor-1 (IGF-1) and insulin receptor tyrosine kinase activity. Exhibits lower IC50 values for IGF-1 than for the insulin receptor. Also inhibits insulin-stimulated cellular proliferation. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11400 |
|---|---|
| Formula | C14H13BrN2O |
| Molecular Weight | 305.2 |
| CAS Number | 65678-07-1 |
| SMILES | CC(C)(C)C1=C(C(=CC(=C1)C=C(C#N)C#N)Br)O |
| Synonyms | AG1024 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 59 mg/mL (193.33 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 1% DMSO+30% polyethylene glycol+1% Tween 80 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.77 mL | 163.83 mL | 327.65 mL |
| 0.5 mM | 6.55 mL | 32.77 mL | 65.53 mL |
| 1 mM | 3.28 mL | 16.38 mL | 32.77 mL |
| 5 mM | 0.66 mL | 3.28 mL | 6.55 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
