Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AG-13958 (AG-013958), a potent VEGFR tyrosine kinase inhibitor, is used for treatment of choroidal neovascularization associated with age-related macular degeneration (AMD). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A21175 |
|---|---|
| Formula | C26H22FN7O |
| Molecular Weight | 467.5 |
| CAS Number | 319460-94-1 |
| SMILES | O=C(C1=CC(C)=NN1C)NC2=CC(NC3=CC4=C(C=C3)C(/C=C/C5=NC=CC=C5)=NN4)=CC=C2F |
| Synonyms | AG 13958, AG13958, AG-013958, AG 013958, AG013958 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 91 mg/mL (194.64 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.39 mL | 106.95 mL | 213.9 mL |
| 0.5 mM | 4.28 mL | 21.39 mL | 42.78 mL |
| 1 mM | 2.14 mL | 10.7 mL | 21.39 mL |
| 5 mM | 0.43 mL | 2.14 mL | 4.28 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
