Loading distributor info...
| Description | Alcaftadine is a high affinity ligand for the H1 receptor, with a pKi (8.5) that is comparable with that of other H1 antihistamines. Alcaftadine is also an antagonist for H2 and H4 receptors with no affinity for the H3 receptor. |
|---|
| Catalog Num | A16393 |
|---|---|
| Formula | C19H21N3O |
| Molecular Weight | 307.39 |
| CAS Number | 147084-10-4 |
| SMILES | CN1CC/C(CC1)=C2C3=CC=CC=C3CCN4C(C=O)=CN=C/24 |
| Synonyms | R89674, R 89674, R-89674 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 26 mg/mL (84.57 mM) | |
| Water | Insoluble | ||
| Ethanol | 57 mg/mL (185.43 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.53 mL | 162.66 mL | 325.32 mL |
| 0.5 mM | 6.51 mL | 32.53 mL | 65.06 mL |
| 1 mM | 3.25 mL | 16.27 mL | 32.53 mL |
| 5 mM | 0.65 mL | 3.25 mL | 6.51 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
