Loading distributor info...
| Description | Alizarin is novelly used as a staining agent in biological research because it stains free calcium and certain calcium compounds a red or light purple color. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A10054 |
|---|---|
| Formula | C14H8O4 |
| Molecular Weight | 240.2 |
| CAS Number | 72-48-0 |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C=C3)O)O |
| Synonyms | Rubia, alizarin crimson, crimson madder, rose madder |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 42 mg/mL (174.84 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.63 mL | 208.16 mL | 416.32 mL |
| 0.5 mM | 8.33 mL | 41.63 mL | 83.26 mL |
| 1 mM | 4.16 mL | 20.82 mL | 41.63 mL |
| 5 mM | 0.83 mL | 4.16 mL | 8.33 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
