Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Alloxazine is an A2 receptor antagonist, which is approximately 10-fold more selective for the A2B receptor than for the A2A receptor. |
|---|
| Catalog Num | A16819 |
|---|---|
| Formula | C10H6N4O2 |
| Molecular Weight | 214.18 |
| CAS Number | 490-59-5 |
| SMILES | C1=CC=C2C(=C1)N=C3C(=N2)NC(=O)NC3=O |
| Synonyms | Alloxazin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 2 mg/mL (9.33 mM) | |
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 46.69 mL | 233.45 mL | 466.9 mL |
| 0.5 mM | 9.34 mL | 46.69 mL | 93.38 mL |
| 1 mM | 4.67 mL | 23.34 mL | 46.69 mL |
| 5 mM | 0.93 mL | 4.67 mL | 9.34 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
