Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Almorexant HCl is an orally active, dual orexin receptor antagonist with IC50 of 6.6 nM and 3.4 nM for OX1 and OX2 receptor 3. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14286 |
|---|---|
| Formula | C29H32ClF3N2O3 |
| Molecular Weight | 549.02 |
| CAS Number | 913358-93-7 |
| SMILES | CNC(=O)[C@@H](C1=CC=CC=C1)N2CCC3=CC(=C(C=C3[C@@H]2CCC4=CC=C(C=C4)C(F)(F)F)OC)OC.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 62 mg/mL (112.93 mM) | |
| Water | Insoluble | ||
| Ethanol | 44 mg/mL (80.14 mM) | ||
| In vivo | 2% DMSO+25% ??-cyclodextrin in saline | 8 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.21 mL | 91.07 mL | 182.14 mL |
| 0.5 mM | 3.64 mL | 18.21 mL | 36.43 mL |
| 1 mM | 1.82 mL | 9.11 mL | 18.21 mL |
| 5 mM | 0.36 mL | 1.82 mL | 3.64 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
