Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Almotriptan malate (Axert) is a selective 5-hydroxytryptamine1B/1D (5-HT1B/1D) receptor agonist, used for the treatment of Migraine attacks in adults. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11799 |
|---|---|
| Formula | C17H25N3O2S.C4H6O5 |
| Molecular Weight | 469.55 |
| CAS Number | 181183-52-8 |
| SMILES | CN(C)CCC1=CNC2=C1C=C(C=C2)CS(=O)(=O)N3CCCC3.C(C(C(=O)O)O)C(=O)O |
| Synonyms | Axert |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 86 mg/mL (183.15 mM) | |
| Water | Insoluble | ||
| Ethanol | 48 mg/mL (102.22 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.3 mL | 106.48 mL | 212.97 mL |
| 0.5 mM | 4.26 mL | 21.3 mL | 42.59 mL |
| 1 mM | 2.13 mL | 10.65 mL | 21.3 mL |
| 5 mM | 0.43 mL | 2.13 mL | 4.26 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
