Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | alpha-Boswellic acid, extracted from Boswellia sacra. |
|---|
| Catalog Num | A15400 |
|---|---|
| Formula | C30H48O3 |
| Molecular Weight | 456.7 |
| CAS Number | 471-66-9 |
| SMILES | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C(=O)O)O)C)C)C2C1)C)C)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 10 mg/mL (21.89 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.9 mL | 109.48 mL | 218.96 mL |
| 0.5 mM | 4.38 mL | 21.9 mL | 43.79 mL |
| 1 mM | 2.19 mL | 10.95 mL | 21.9 mL |
| 5 mM | 0.44 mL | 2.19 mL | 4.38 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
