Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Amezinium Metilsulfate, also known as Regulton and LU-1631, is a norepinephrine reuptake inhibitor which exclusively affects postganglionic sympathetic neurons. Amezinium Metilsulfate is used to treat hypotension. |
|---|
| Catalog Num | A18103 |
|---|---|
| Formula | C12H15N3O5S |
| Molecular Weight | 313.33 |
| CAS Number | 30578-37-1 |
| SMILES | COC1=CC(N)=CN=[N+]1C2=CC=CC=C2.O=S(OC)([O-])=O |
| Synonyms | Amezinium Metilsulfate; LU-1631; LU 1631; LU1631; Regulton; Risumic |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 60 mg/mL (191.49 mM) | |
| Water | 31 mg/mL (98.93 mM) | ||
| Ethanol | 5 mg/mL (15.95 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.92 mL | 159.58 mL | 319.15 mL |
| 0.5 mM | 6.38 mL | 31.92 mL | 63.83 mL |
| 1 mM | 3.19 mL | 15.96 mL | 31.92 mL |
| 5 mM | 0.64 mL | 3.19 mL | 6.38 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
