Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Amfebutamone (Bupropion) is an atypical antidepressant and smoking cessation aid. |
|---|
| Catalog Num | A10061 |
|---|---|
| Formula | C13H18ClNO.HCl |
| Molecular Weight | 276.2 |
| CAS Number | 31677-93-7 |
| SMILES | CC(C(=O)C1=CC(=CC=C1)Cl)NC(C)(C)C.Cl |
| Synonyms | Wellbutrin, Zyban, Voxra, Budeprion, Aplenzin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 8 mg/mL (28.96 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.21 mL | 181.03 mL | 362.06 mL |
| 0.5 mM | 7.24 mL | 36.21 mL | 72.41 mL |
| 1 mM | 3.62 mL | 18.1 mL | 36.21 mL |
| 5 mM | 0.72 mL | 3.62 mL | 7.24 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
