Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AMI5 is a non-selective protein methyltransferase inhibitor. |
|---|
| Catalog Num | A16376 |
|---|---|
| Formula | C20H6Br4Na2O5 |
| Molecular Weight | 691.85 |
| CAS Number | 17372-87-1 |
| SMILES | BrC1=C([O-])C(Br)=C2C(C(C3=CC=CC=C3C([O-])=O)=C4C=C(Br)C(C(Br)=C4O2)=O)=C1.[Na+].[Na+] |
| Synonyms | AMI 5, AMI-5 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 88 mg/mL (127.2 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 14.45 mL | 72.27 mL | 144.54 mL |
| 0.5 mM | 2.89 mL | 14.45 mL | 28.91 mL |
| 1 mM | 1.45 mL | 7.23 mL | 14.45 mL |
| 5 mM | 0.29 mL | 1.45 mL | 2.89 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
