Loading distributor info...
| Description | Amprolium chloride is a thiamin antagonist, which prevents carbohydrate synthesis by blocking thiamine uptake. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16410 |
|---|---|
| Formula | C14H19N4.HCl.Cl |
| Molecular Weight | 315.24 |
| CAS Number | 137-88-2 |
| SMILES | CCCC1=NC=C(C(=N1)N)C[N+]2=CC=CC=C2C.Cl.[Cl-] |
| Synonyms | Amprolium hydrochloride |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 2 mg/mL (6.34 mM) | |
| Water | 58 mg/mL (183.98 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.72 mL | 158.61 mL | 317.22 mL |
| 0.5 mM | 6.34 mL | 31.72 mL | 63.44 mL |
| 1 mM | 3.17 mL | 15.86 mL | 31.72 mL |
| 5 mM | 0.63 mL | 3.17 mL | 6.34 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
