Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | AN2728 is a topically administered, boron-containing, anti-inflammatory compound that inhibits PDE4 activity and thereby suppresses the release of TNFalpha, IL-12, IL-23 and other cytokines |
|---|
| Catalog Num | A12776 |
|---|---|
| Formula | C14H10BNO3 |
| Molecular Weight | 251.08 |
| CAS Number | 906673-24-3 |
| SMILES | B1(C2=C(CO1)C=C(C=C2)OC3=CC=C(C=C3)C#N)O |
| Synonyms | AN 2728, AN-2728 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 47 mg/mL (187.21 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 39.83 mL | 199.14 mL | 398.28 mL |
| 0.5 mM | 7.97 mL | 39.83 mL | 79.66 mL |
| 1 mM | 3.98 mL | 19.91 mL | 39.83 mL |
| 5 mM | 0.8 mL | 3.98 mL | 7.97 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
