Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Andarine (GTX-007) is an investigational selective androgen receptor modulator (SARM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10076 |
|---|---|
| Formula | C19H18F3N3O6 |
| Molecular Weight | 441.4 |
| CAS Number | 401900-40-1 |
| SMILES | CC(=O)NC1=CC=C(C=C1)OC[C@@](C)(C(=O)NC2=CC(=C(C=C2)[N+](=O)[O-])C(F)(F)F)O |
| Synonyms | S-4 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 80 mg/mL (181.25 mM) | |
| Water | Insoluble | ||
| Ethanol | 80 mg/mL (181.25 mM) | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.66 mL | 113.28 mL | 226.55 mL |
| 0.5 mM | 4.53 mL | 22.66 mL | 45.31 mL |
| 1 mM | 2.27 mL | 11.33 mL | 22.66 mL |
| 5 mM | 0.45 mL | 2.27 mL | 4.53 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
