Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Aniracetam is an ampakine and nootropic of the racetam chemical class purported to be considerably more potent than piracetam. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10078 |
|---|---|
| Formula | C12H13NO3 |
| Molecular Weight | 219.24 |
| CAS Number | 72432-10-1 |
| SMILES | COC1=CC=C(C=C1)C(=O)N2CCCC2=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 38 mg/mL (173.32 mM) | |
| Water | Insoluble | ||
| Ethanol | 15 mg/mL (68.42 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 45.61 mL | 228.06 mL | 456.12 mL |
| 0.5 mM | 9.12 mL | 45.61 mL | 91.22 mL |
| 1 mM | 4.56 mL | 22.81 mL | 45.61 mL |
| 5 mM | 0.91 mL | 4.56 mL | 9.12 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
