Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Apronalide, also known as Allylisopropylacetylurea or Apronal, is a hypnotic/sedative drug of the ureide (acylurea) group which may induce cytochrome P-450 through barbiturate-like activity. |
|---|
| Catalog Num | A18208 |
|---|---|
| Formula | C9H16N2O2 |
| Molecular Weight | 184.24 |
| CAS Number | 528-92-7 |
| SMILES | C([C@@H](CC=C)C(C)C)(NC(N)=O)=O |
| Synonyms | Allylisopropylacetylurea, Apronal, Apronalide, Isodormid, Sedormid |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 33 mg/mL (179.11 mM) | |
| Water | Insoluble | ||
| Ethanol | 16 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 54.28 mL | 271.39 mL | 542.77 mL |
| 0.5 mM | 10.86 mL | 54.28 mL | 108.55 mL |
| 1 mM | 5.43 mL | 27.14 mL | 54.28 mL |
| 5 mM | 1.09 mL | 5.43 mL | 10.86 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
