Loading distributor info...
| Description | ARN-3236 is potent, orally active and selective SIK2 inhibitor. ARN-3236 inhibited the growth of 10 ovarian cancer cell lines at an IC50 of 0.8 to 2.6 μmol/L. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A18725 |
|---|---|
| Formula | C19H16N2O2S |
| Molecular Weight | 336.4 |
| CAS Number | 1613710-01-2 |
| SMILES | COC1=CC=C(C2=CNC3=NC=CC(C4=CSC=C4)=C32)C(OC)=C1 |
| Synonyms | ARN-3236; ARN 3236; ARN3236. |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 62 mg/mL (184.3 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (5.94 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.73 mL | 148.63 mL | 297.27 mL |
| 0.5 mM | 5.95 mL | 29.73 mL | 59.45 mL |
| 1 mM | 2.97 mL | 14.86 mL | 29.73 mL |
| 5 mM | 0.59 mL | 2.97 mL | 5.95 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
