Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ARQ 621 is an allosteric, and selective Eg5 mitotic motor protein inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14234 |
|---|---|
| Formula | C28H24Cl2FN5O2 |
| Molecular Weight | 552.43 |
| CAS Number | 1095253-39-6 |
| SMILES | C#CC[C@H](C1=NC2=C(C=CC(=C2)Cl)C(=O)N1NC3=CC=CC=C3)N(CCCN)C(=O)C4=C(C(=CC=C4)Cl)F |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 89 mg/mL (161.1 mM) | |
| Water | Insoluble | ||
| Ethanol | 89 mg/mL (161.1 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.1 mL | 90.51 mL | 181.02 mL |
| 0.5 mM | 3.62 mL | 18.1 mL | 36.2 mL |
| 1 mM | 1.81 mL | 9.05 mL | 18.1 mL |
| 5 mM | 0.36 mL | 1.81 mL | 3.62 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
