Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ARS-1620 is a potent, orally bioavailable covalent inhibitor of KRAS-G12C) and could achieve rapid and sustained in vivo target occupancy to induce tumor regression. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16809 |
|---|---|
| Formula | C21H17ClF2N4O2 |
| Molecular Weight | 430.84 |
| CAS Number | 1698055-85-4 |
| SMILES | FC1=CC=CC(O)=C1C2=C(Cl)C=C(C(N3CCN(C(C=C)=O)CC3)=NC=N4)C4=C2F |
| Synonyms | ARS1620, ARS 1620 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 82 mg/mL (190.33 mM) | |
| Water | Insoluble | ||
| Ethanol | 57 mg/mL (132.3 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.21 mL | 116.05 mL | 232.1 mL |
| 0.5 mM | 4.64 mL | 23.21 mL | 46.42 mL |
| 1 mM | 2.32 mL | 11.61 mL | 23.21 mL |
| 5 mM | 0.46 mL | 2.32 mL | 4.64 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
