Loading distributor info...
| Description | Articaine is a dental local anesthetic which contains an additional ester group that is metabolized by estearases in blood and tissue. |
|---|
| Catalog Num | A11808 |
|---|---|
| Formula | C13H20N2O3S.HCl |
| Molecular Weight | 320.84 |
| CAS Number | 23964-57-0 |
| SMILES | CCCNC(C)C(=O)NC1=C(SC=C1C)C(=O)OC.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 58 mg/mL (180.77 mM) | |
| Water | 58 mg/mL (180.77 mM) | ||
| Ethanol | 58 mg/mL (180.77 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.17 mL | 155.84 mL | 311.68 mL |
| 0.5 mM | 6.23 mL | 31.17 mL | 62.34 mL |
| 1 mM | 3.12 mL | 15.58 mL | 31.17 mL |
| 5 mM | 0.62 mL | 3.12 mL | 6.23 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
