Loading distributor info...
| Description | ARV-771 is a potent BET degrader based on PROTAC technology with Kds of 34, 4.7, 8.3, 7.6, 9.6, and 7.6 nM for BRD2(1), BRD2(2), BRD3(1), BRD3(2), BRD4(1), and BRD4(2), respectively. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A13255 |
|---|---|
| Formula | C49H60ClN9O7S2 |
| Molecular Weight | 986.64 |
| CAS Number | 1949837-12-0 |
| SMILES | CC(C(C(C1=CC=C(Cl)C=C1)=N[C@@H](CC(NCCOCCCOCC(N[C@@H](C(C)(C)C)C(N(C[C@H](O)C2)[C@@H]2C(N[C@H](C3=CC=C(C(SC=N4)=C4C)C=C3)C)=O)=O)=O)=O)C5=NN=C(C)N65)=C6S7)=C7C |
| Synonyms | ARV771, ARV 771 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 97 mg/mL (98.31 mM) | |
| Water | Insoluble | ||
| Ethanol | 97 mg/mL (98.31 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 10.14 mL | 50.68 mL | 101.35 mL |
| 0.5 mM | 2.03 mL | 10.14 mL | 20.27 mL |
| 1 mM | 1.01 mL | 5.07 mL | 10.14 mL |
| 5 mM | 0.2 mL | 1.01 mL | 2.03 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
