Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | ARV-825 is a hetero-bifunctional molecule that is composed of a BRD4 binding moiety joined to an E3 ligase cereblon binding moiety using proteolysis targeting chimera (PROTAC) technology. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A16859 |
|---|---|
| Formula | C46H47ClN8O9S |
| Molecular Weight | 923.44 |
| CAS Number | 1818885-28-7 |
| SMILES | O=C(NC1=CC=C(OCCOCCOCCOCCNC2=CC=CC(C(N3C(CC4)C(NC4=O)=O)=O)=C2C3=O)C=C1)C[C@H]5C6=NN=C(C)N6C7=C(C(C)=C(C)S7)C(C8=CC=C(Cl)C=C8)=N5 |
| Synonyms | ARV825, ARV 825 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 97 mg/mL (105.04 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (3.24 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 10.83 mL | 54.15 mL | 108.29 mL |
| 0.5 mM | 2.17 mL | 10.83 mL | 21.66 mL |
| 1 mM | 1.08 mL | 5.41 mL | 10.83 mL |
| 5 mM | 0.22 mL | 1.08 mL | 2.17 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
