Loading distributor info...
| Description | AS-35 is an orally effective, potent and selective antagonist of leukotrienes, antagonizes LTC4-, LTD4 and LTE4-induced contractions of the ileum with IC50 values of 8 nM, 4 nM and 3 nM, respectively, and has antiallergic activities. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19409 |
|---|---|
| Formula | C21H20N6O4 |
| Molecular Weight | 420.42 |
| CAS Number | 108427-72-1 |
| SMILES | O=C1C(C2=NN=NN2)=CN=C3N1C=CC=C3COC4=CC=C(C(C)=O)C(O)=C4CCC |
| Synonyms | AS35, AS 35 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
