Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ASP8273 is an orally available, irreversible, third-generation, mutant-selective, epidermal growth factor receptor (EGFR) inhibitor, with potential antineoplastic activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14408 |
|---|---|
| Formula | C30H42N8O3 |
| Molecular Weight | 562.72 |
| CAS Number | 1448232-80-1 |
| SMILES | O=C(C1=NC(CC)=C(O[C@H]2CN(C(C=C)=O)CC2)N=C1NC3=CC=C(N4CCC(N5CCN(C)CC5)CC4)C=C3)N |
| Synonyms | Naquotinib (free base) |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 50 mg/mL (88.85 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 96 mg/mL (170.6 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.77 mL | 88.85 mL | 177.71 mL |
| 0.5 mM | 3.55 mL | 17.77 mL | 35.54 mL |
| 1 mM | 1.78 mL | 8.89 mL | 17.77 mL |
| 5 mM | 0.36 mL | 1.78 mL | 3.55 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
