Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Aspartame is a methyl ester of the dipeptide of the natural amino acids L-aspartic acid and L-phenylalanine. Under strongly acidic or alkaline conditions, aspartame may generate methanol by hydrolysis. |
|---|
| Catalog Num | A11698 |
|---|---|
| Formula | C14H18N2O5 |
| Molecular Weight | 294.3 |
| CAS Number | 22839-47-0 |
| SMILES | COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CC(=O)O)N |
| Synonyms | APM |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 30 mg/mL (101.94 mM) | |
| Water | 4 mg/mL (13.59 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.98 mL | 169.89 mL | 339.79 mL |
| 0.5 mM | 6.8 mL | 33.98 mL | 67.96 mL |
| 1 mM | 3.4 mL | 16.99 mL | 33.98 mL |
| 5 mM | 0.68 mL | 3.4 mL | 6.8 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
