Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AST-6 is a novel irreversible inhibitor of the epidermal growth factor receptor 1 and 2, inhibits tumor growth both in vitro and in vivo | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10062 |
|---|---|
| Formula | C24H18ClFN4O2.C7H8O3S |
| Molecular Weight | 621.1 |
| CAS Number | 1050500-29-2 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C=CC(=O)NC1=CC2=C(C=C1)N=CN=C2NC3=CC(=C(C=C3)OCC4=CC(=CC=C4)F)Cl |
| Synonyms | AST6 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 115 mg/mL (185.16 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 0.5% hydroxyethyl cellulose | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.1 mL | 80.5 mL | 161 mL |
| 0.5 mM | 3.22 mL | 16.1 mL | 32.2 mL |
| 1 mM | 1.61 mL | 8.05 mL | 16.1 mL |
| 5 mM | 0.32 mL | 1.61 mL | 3.22 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
