Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Atipamezole is a synthetic α2-adrenoceptor antagonist with a Ki of 1.6 nM. |
|---|
| Catalog Num | A21363 |
|---|---|
| Formula | C14H16N2 |
| Molecular Weight | 212.29 |
| CAS Number | 104054-27-5 |
| SMILES | CCC1(C2=CN=CN2)CC3=C(C=CC=C3)C1 |
| Synonyms | MPV 1248, MPV-1248, MPV1248 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 42 mg/mL (197.84 mM) | |
| Water | Insoluble | ||
| Ethanol | 42 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 47.11 mL | 235.53 mL | 471.05 mL |
| 0.5 mM | 9.42 mL | 47.11 mL | 94.21 mL |
| 1 mM | 4.71 mL | 23.55 mL | 47.11 mL |
| 5 mM | 0.94 mL | 4.71 mL | 9.42 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
